C18H14N2O — CID 12648620
(E)-4-(3,6-dihydropyrrolo[2,3-c]carbazol-1-yl)but-3-en-2-one (PubChem CID 12648620) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is (E)-4-(3,6-dihydropyrrolo[2,3-c]carbazol-1-yl)but-3-en-2-one.
| Compound Name | (E)-4-(3,6-dihydropyrrolo[2,3-c]carbazol-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 12648620 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (E)-4-(3,6-dihydropyrrolo[2,3-c]carbazol-1-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1c[nH]c2ccc3[nH]c4ccccc4c3c12 |
| InChI | InChI=1S/C18H14N2O/c1-11(21)6-7-12-10-19-15-8-9-16-18(17(12)15)13-4-2-3-5-14(13)20-16/h2-10,19-20H,1H3/b7-6+ |
| InChIKey | UGTNFWGEGAUJAG-VOTSOKGWSA-N |
| XLogP | 4.40 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|