C7H8N2O6 — CID 163712906
5-methyl-1H-pyrimidine-2,4-dione;oxalic acid (PubChem CID 163712906) has the molecular formula C7H8N2O6 and a molecular weight of 216.15 g/mol. Its IUPAC name is 5-methyl-1H-pyrimidine-2,4-dione;oxalic acid.
| Compound Name | 5-methyl-1H-pyrimidine-2,4-dione;oxalic acid |
|---|---|
| PubChem CID | 163712906 |
| Molecular Formula | C7H8N2O6 |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 5-methyl-1H-pyrimidine-2,4-dione;oxalic acid |
| SMILES | Cc1c[nH]c(=O)[nH]c1=O.O=C(O)C(=O)O |
| InChI | InChI=1S/C5H6N2O2.C2H2O4/c1-3-2-6-5(9)7-4(3)8;3-1(4)2(5)6/h2H,1H3,(H2,6,7,8,9);(H,3,4)(H,5,6) |
| InChIKey | KKVMBPZAIXZOGZ-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|