C10H12N2O6 — CID 118238904
2-methylidenebutanedioic acid;5-methyl-1H-pyrimidine-2,4-dione (PubChem CID 118238904) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is 2-methylidenebutanedioic acid;5-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 2-methylidenebutanedioic acid;5-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118238904 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-methylidenebutanedioic acid;5-methyl-1H-pyrimidine-2,4-dione |
| SMILES | C=C(CC(=O)O)C(=O)O.Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H6N2O2.C5H6O4/c1-3-2-6-5(9)7-4(3)8;1-3(5(8)9)2-4(6)7/h2H,1H3,(H2,6,7,8,9);1-2H2,(H,6,7)(H,8,9) |
| InChIKey | XHEVUOMZOKVJKA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|