C10H14N7O7P — CID 159240828
2-amino-1,7-dihydropurin-6-one;5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid (PubChem CID 159240828) has the molecular formula C10H14N7O7P and a molecular weight of 375.24 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid.
| Compound Name | 2-amino-1,7-dihydropurin-6-one;5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid |
|---|---|
| PubChem CID | 159240828 |
| Molecular Formula | C10H14N7O7P |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid |
| SMILES | Cc1c[nH]c(=O)[nH]c1=O.Nc1nc2nc[nH]c2c(=O)[nH]1.O=P(O)(O)O |
| InChI | InChI=1S/C5H5N5O.C5H6N2O2.H3O4P/c6-5-9-3-2(4(11)10-5)7-1-8-3;1-3-2-6-5(9)7-4(3)8;1-5(2,3)4/h1H,(H4,6,7,8,9,10,11);2H,1H3,(H2,6,7,8,9);(H3,1,2,3,4) |
| InChIKey | KUBMPHJIPULTKX-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 243.93 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|