C15H18N10O3S — CID 165091537
5-methyl-1H-pyrimidine-2,4-dione;5-methyl-2-sulfanylidene-1H-pyrimidin-4-one;7H-purine-2,6-diamine (PubChem CID 165091537) has the molecular formula C15H18N10O3S and a molecular weight of 418.44 g/mol. Its IUPAC name is 5-methyl-1H-pyrimidine-2,4-dione;5-methyl-2-sulfanylidene-1H-pyrimidin-4-one;7H-purine-2,6-diamine.
| Compound Name | 5-methyl-1H-pyrimidine-2,4-dione;5-methyl-2-sulfanylidene-1H-pyrimidin-4-one;7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 165091537 |
| Molecular Formula | C15H18N10O3S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 5-methyl-1H-pyrimidine-2,4-dione;5-methyl-2-sulfanylidene-1H-pyrimidin-4-one;7H-purine-2,6-diamine |
| SMILES | Cc1c[nH]c(=O)[nH]c1=O.Cc1c[nH]c(=S)[nH]c1=O.Nc1nc(N)c2[nH]cnc2n1 |
| InChI | InChI=1S/C5H6N6.C5H6N2O2.C5H6N2OS/c6-3-2-4(9-1-8-2)11-5(7)10-3;2*1-3-2-6-5(9)7-4(3)8/h1H,(H5,6,7,8,9,10,11);2*2H,1H3,(H2,6,7,8,9) |
| InChIKey | WUGCDBIVHJNKNV-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 220.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|