C10H12N8O2 — CID 159740059
3-methyl-1H-pyrimidine-2,4-dione;7H-purine-2,6-diamine (PubChem CID 159740059) has the molecular formula C10H12N8O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 3-methyl-1H-pyrimidine-2,4-dione;7H-purine-2,6-diamine.
| Compound Name | 3-methyl-1H-pyrimidine-2,4-dione;7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 159740059 |
| Molecular Formula | C10H12N8O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-methyl-1H-pyrimidine-2,4-dione;7H-purine-2,6-diamine |
| SMILES | Cn1c(=O)cc[nH]c1=O.Nc1nc(N)c2[nH]cnc2n1 |
| InChI | InChI=1S/C5H6N6.C5H6N2O2/c6-3-2-4(9-1-8-2)11-5(7)10-3;1-7-4(8)2-3-6-5(7)9/h1H,(H5,6,7,8,9,10,11);2-3H,1H3,(H,6,9) |
| InChIKey | NCINDHXILNHUHW-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |