C9H9N7 — CID 114786706
6-(3-methylpyrazol-1-yl)-7H-purin-2-amine (PubChem CID 114786706) has the molecular formula C9H9N7 and a molecular weight of 215.22 g/mol. Its IUPAC name is 6-(3-methylpyrazol-1-yl)-7H-purin-2-amine.
| Compound Name | 6-(3-methylpyrazol-1-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 114786706 |
| Molecular Formula | C9H9N7 |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 6-(3-methylpyrazol-1-yl)-7H-purin-2-amine |
| SMILES | Cc1ccn(-c2nc(N)nc3nc[nH]c23)n1 |
| InChI | InChI=1S/C9H9N7/c1-5-2-3-16(15-5)8-6-7(12-4-11-6)13-9(10)14-8/h2-4H,1H3,(H3,10,11,12,13,14) |
| InChIKey | UZTXURSXWDICJW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |