C10H10BrN7 — CID 114786682
6-(4-bromo-3,5-dimethylpyrazol-1-yl)-7H-purin-2-amine (PubChem CID 114786682) has the molecular formula C10H10BrN7 and a molecular weight of 308.14 g/mol. Its IUPAC name is 6-(4-bromo-3,5-dimethylpyrazol-1-yl)-7H-purin-2-amine.
| Compound Name | 6-(4-bromo-3,5-dimethylpyrazol-1-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 114786682 |
| Molecular Formula | C10H10BrN7 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 6-(4-bromo-3,5-dimethylpyrazol-1-yl)-7H-purin-2-amine |
| SMILES | Cc1nn(-c2nc(N)nc3nc[nH]c23)c(C)c1Br |
| InChI | InChI=1S/C10H10BrN7/c1-4-6(11)5(2)18(17-4)9-7-8(14-3-13-7)15-10(12)16-9/h3H,1-2H3,(H3,12,13,14,15,16) |
| InChIKey | HRGYABGPJCDZEL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |