C8H8N8 — CID 79521441
5-methyl-1-(7H-purin-6-yl)-1,2,4-triazol-3-amine (PubChem CID 79521441) has the molecular formula C8H8N8 and a molecular weight of 216.21 g/mol. Its IUPAC name is 5-methyl-1-(7H-purin-6-yl)-1,2,4-triazol-3-amine.
| Compound Name | 5-methyl-1-(7H-purin-6-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 79521441 |
| Molecular Formula | C8H8N8 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 5-methyl-1-(7H-purin-6-yl)-1,2,4-triazol-3-amine |
| SMILES | Cc1nc(N)nn1-c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C8H8N8/c1-4-14-8(9)15-16(4)7-5-6(11-2-10-5)12-3-13-7/h2-3H,1H3,(H2,9,15)(H,10,11,12,13) |
| InChIKey | HPPVWAWYUUCKIQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |