C10H11N5S — CID 170739483
6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine (PubChem CID 170739483) has the molecular formula C10H11N5S and a molecular weight of 233.30 g/mol. Its IUPAC name is 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine.
| Compound Name | 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine |
|---|---|
| PubChem CID | 170739483 |
| Molecular Formula | C10H11N5S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine |
| SMILES | CC1=CN(c2ncnc3nc[nH]c23)CCS1 |
| InChI | InChI=1S/C10H11N5S/c1-7-4-15(2-3-16-7)10-8-9(12-5-11-8)13-6-14-10/h4-6H,2-3H2,1H3,(H,11,12,13,14) |
| InChIKey | RHUHOCNBUGASBH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |