About 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine
6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine (PubChem CID 170739483) has the molecular formula C10H11N5S
and a molecular weight of 233.30 g/mol. Its IUPAC name is 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine.
Molecular Properties
| Compound Name | 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine |
| PubChem CID | 170739483 |
| Molecular Formula | C10H11N5S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine |
| SMILES | CC1=CN(c2ncnc3nc[nH]c23)CCS1 |
| InChI | InChI=1S/C10H11N5S/c1-7-4-15(2-3-16-7)10-8-9(12-5-11-8)13-6-14-10/h4-6H,2-3H2,1H3,(H,11,12,13,14) |
| InChIKey | RHUHOCNBUGASBH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine?
The IUPAC name of 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine (CID 170739483) is 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine.
What is the SMILES notation for 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine?
The canonical SMILES for 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine is CC1=CN(c2ncnc3nc[nH]c23)CCS1.
What is the InChIKey of 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine?
The InChIKey is RHUHOCNBUGASBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5S/c1-7-4-15(2-3-16-7)10-8-9(12-5-11-8)13-6-14-10/h4-6H,2-3H2,1H3,(H,11,12,13,14).
What are the key properties of 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine?
6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine has a molecular weight of 233.30 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine is sourced from PubChem (CID 170739483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).