C13H15N7O2S — CID 174180448
N-(2-formamidoethyl)-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine-6-carboxamide (PubChem CID 174180448) has the molecular formula C13H15N7O2S and a molecular weight of 333.38 g/mol. Its IUPAC name is N-(2-formamidoethyl)-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine-6-carboxamide.
| Compound Name | N-(2-formamidoethyl)-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 174180448 |
| Molecular Formula | C13H15N7O2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(2-formamidoethyl)-4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazine-6-carboxamide |
| SMILES | O=CNCCNC(=O)C1=CN(c2ncnc3nc[nH]c23)CCS1 |
| InChI | InChI=1S/C13H15N7O2S/c21-8-14-1-2-15-13(22)9-5-20(3-4-23-9)12-10-11(17-6-16-10)18-7-19-12/h5-8H,1-4H2,(H,14,21)(H,15,22)(H,16,17,18,19) |
| InChIKey | VMJPABRJNDEIOC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|