C15H19N7S — CID 176678205
piperidin-1-yl-[4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazin-6-yl]methanimine (PubChem CID 176678205) has the molecular formula C15H19N7S and a molecular weight of 329.43 g/mol. Its IUPAC name is piperidin-1-yl-[4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazin-6-yl]methanimine.
| Compound Name | piperidin-1-yl-[4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazin-6-yl]methanimine |
|---|---|
| PubChem CID | 176678205 |
| Molecular Formula | C15H19N7S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | piperidin-1-yl-[4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazin-6-yl]methanimine |
| SMILES | [H]/N=C(/C1=CN(c2ncnc3nc[nH]c23)CCS1)N1CCCCC1 |
| InChI | InChI=1S/C15H19N7S/c16-13(21-4-2-1-3-5-21)11-8-22(6-7-23-11)15-12-14(18-9-17-12)19-10-20-15/h8-10,16H,1-7H2,(H,17,18,19,20)/b16-13- |
| InChIKey | JIPGYQHPSIVFGJ-SSZFMOIBSA-N |
| XLogP | 2.21 |
| TPSA | 84.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|