C12H13N7S — CID 176678556
(Z)-3-imino-1-[4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazin-6-yl]prop-1-en-1-amine (PubChem CID 176678556) has the molecular formula C12H13N7S and a molecular weight of 287.35 g/mol. Its IUPAC name is (Z)-3-imino-1-[4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazin-6-yl]prop-1-en-1-amine.
| Compound Name | (Z)-3-imino-1-[4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazin-6-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 176678556 |
| Molecular Formula | C12H13N7S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (Z)-3-imino-1-[4-(7H-purin-6-yl)-2,3-dihydro-1,4-thiazin-6-yl]prop-1-en-1-amine |
| SMILES | [H]/N=C/C=C(\N)C1=CN(c2ncnc3nc[nH]c23)CCS1 |
| InChI | InChI=1S/C12H13N7S/c13-2-1-8(14)9-5-19(3-4-20-9)12-10-11(16-6-15-10)17-7-18-12/h1-2,5-7,13H,3-4,14H2,(H,15,16,17,18)/b8-1-,13-2+ |
| InChIKey | RNECPWPSMKQLFG-VHRDNPJLSA-N |
| XLogP | 1.24 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|