C14H17N5O2 — CID 79610586
2-[8-(7H-purin-6-yl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid (PubChem CID 79610586) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-[8-(7H-purin-6-yl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid.
| Compound Name | 2-[8-(7H-purin-6-yl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
|---|---|
| PubChem CID | 79610586 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-[8-(7H-purin-6-yl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
| SMILES | O=C(O)CC1CC2CCC(C1)N2c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H17N5O2/c20-11(21)5-8-3-9-1-2-10(4-8)19(9)14-12-13(16-6-15-12)17-7-18-14/h6-10H,1-5H2,(H,20,21)(H,15,16,17,18) |
| InChIKey | UJHCAGLSYIAZRY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |