C11H15N7O — CID 70769924
(2S,4R)-4-amino-N-methyl-1-(7H-purin-6-yl)pyrrolidine-2-carboxamide (PubChem CID 70769924) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is (2S,4R)-4-amino-N-methyl-1-(7H-purin-6-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-amino-N-methyl-1-(7H-purin-6-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70769924 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (2S,4R)-4-amino-N-methyl-1-(7H-purin-6-yl)pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H](N)CN1c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H15N7O/c1-13-11(19)7-2-6(12)3-18(7)10-8-9(15-4-14-8)16-5-17-10/h4-7H,2-3,12H2,1H3,(H,13,19)(H,14,15,16,17)/t6-,7+/m1/s1 |
| InChIKey | XTQXUAJISPDQRO-RQJHMYQMSA-N |
| XLogP | -1.00 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |