C13H18N6O — CID 166358719
2-[4,4-dimethyl-1-(7H-purin-6-yl)pyrrolidin-2-yl]acetamide (PubChem CID 166358719) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-[4,4-dimethyl-1-(7H-purin-6-yl)pyrrolidin-2-yl]acetamide.
| Compound Name | 2-[4,4-dimethyl-1-(7H-purin-6-yl)pyrrolidin-2-yl]acetamide |
|---|---|
| PubChem CID | 166358719 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-[4,4-dimethyl-1-(7H-purin-6-yl)pyrrolidin-2-yl]acetamide |
| SMILES | CC1(C)CC(CC(N)=O)N(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C13H18N6O/c1-13(2)4-8(3-9(14)20)19(5-13)12-10-11(16-6-15-10)17-7-18-12/h6-8H,3-5H2,1-2H3,(H2,14,20)(H,15,16,17,18) |
| InChIKey | PUKPXWCOYJVFGM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |