C12H18N6 — CID 55090865
[6-methyl-1-(7H-purin-6-yl)piperidin-3-yl]methanamine (PubChem CID 55090865) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is [6-methyl-1-(7H-purin-6-yl)piperidin-3-yl]methanamine.
| Compound Name | [6-methyl-1-(7H-purin-6-yl)piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 55090865 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | [6-methyl-1-(7H-purin-6-yl)piperidin-3-yl]methanamine |
| SMILES | CC1CCC(CN)CN1c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H18N6/c1-8-2-3-9(4-13)5-18(8)12-10-11(15-6-14-10)16-7-17-12/h6-9H,2-5,13H2,1H3,(H,14,15,16,17) |
| InChIKey | UHNJTNYGDJOFSJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |