C9H8N6S — CID 62409844
5-methyl-2-(7H-purin-6-yl)-1H-pyrazole-3-thione (PubChem CID 62409844) has the molecular formula C9H8N6S and a molecular weight of 232.27 g/mol. Its IUPAC name is 5-methyl-2-(7H-purin-6-yl)-1H-pyrazole-3-thione.
| Compound Name | 5-methyl-2-(7H-purin-6-yl)-1H-pyrazole-3-thione |
|---|---|
| PubChem CID | 62409844 |
| Molecular Formula | C9H8N6S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 5-methyl-2-(7H-purin-6-yl)-1H-pyrazole-3-thione |
| SMILES | Cc1cc(=S)n(-c2ncnc3nc[nH]c23)[nH]1 |
| InChI | InChI=1S/C9H8N6S/c1-5-2-6(16)15(14-5)9-7-8(11-3-10-7)12-4-13-9/h2-4,14H,1H3,(H,10,11,12,13) |
| InChIKey | ZJURHAVCIISDBK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|