About butane;6-methyl-7H-purine;molecular hydrogen
butane;6-methyl-7H-purine;molecular hydrogen (PubChem CID 176672548) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is butane;6-methyl-7H-purine;molecular hydrogen.
Molecular Properties
| Compound Name | butane;6-methyl-7H-purine;molecular hydrogen |
| PubChem CID | 176672548 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | butane;6-methyl-7H-purine;molecular hydrogen |
| SMILES | CCCC.Cc1ncnc2nc[nH]c12.[H][H] |
| InChI | InChI=1S/C6H6N4.C4H10.H2/c1-4-5-6(9-2-7-4)10-3-8-5;1-3-4-2;/h2-3H,1H3,(H,7,8,9,10);3-4H2,1-2H3;1H |
| InChIKey | JSGMVAHKOXKMTN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butane;6-methyl-7H-purine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;6-methyl-7H-purine;molecular hydrogen?
The IUPAC name of butane;6-methyl-7H-purine;molecular hydrogen (CID 176672548) is butane;6-methyl-7H-purine;molecular hydrogen.
What is the SMILES notation for butane;6-methyl-7H-purine;molecular hydrogen?
The canonical SMILES for butane;6-methyl-7H-purine;molecular hydrogen is CCCC.Cc1ncnc2nc[nH]c12.[H][H].
What is the InChIKey of butane;6-methyl-7H-purine;molecular hydrogen?
The InChIKey is JSGMVAHKOXKMTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4.C4H10.H2/c1-4-5-6(9-2-7-4)10-3-8-5;1-3-4-2;/h2-3H,1H3,(H,7,8,9,10);3-4H2,1-2H3;1H.
What are the key properties of butane;6-methyl-7H-purine;molecular hydrogen?
butane;6-methyl-7H-purine;molecular hydrogen has a molecular weight of 194.28 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;6-methyl-7H-purine;molecular hydrogen is sourced from PubChem (CID 176672548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).