molecular hydrogen;6-propan-2-yl-7H-purine

C8H12N4 — CID 171499387

IUPACmolecular hydrogen;6-propan-2-yl-7H-purine
SMILESCC(C)c1ncnc2nc[nH]c12.[H][H]
InChIInChI=1S/C8H10N4.H2/c1-5(2)6-7-8(11-3-9-6)12-4-10-7;/h3-5H,1-2H3,(H,9,10,11,12);1H
InChIKeyDNHHCDWTNJOMJA-UHFFFAOYSA-N
MW164.21 g/mol
LogP1.72
Rot. Bonds1

About molecular hydrogen;6-propan-2-yl-7H-purine

molecular hydrogen;6-propan-2-yl-7H-purine (PubChem CID 171499387) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is molecular hydrogen;6-propan-2-yl-7H-purine.

Molecular Properties

Compound Namemolecular hydrogen;6-propan-2-yl-7H-purine
PubChem CID171499387
Molecular FormulaC8H12N4
Molecular Weight164.21 g/mol
Exact Mass164.11
IUPAC Namemolecular hydrogen;6-propan-2-yl-7H-purine
SMILESCC(C)c1ncnc2nc[nH]c12.[H][H]
InChIInChI=1S/C8H10N4.H2/c1-5(2)6-7-8(11-3-9-6)12-4-10-7;/h3-5H,1-2H3,(H,9,10,11,12);1H
InChIKeyDNHHCDWTNJOMJA-UHFFFAOYSA-N
XLogP1.72
TPSA54.46 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.21
LogP ≤ 51.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze molecular hydrogen;6-propan-2-yl-7H-purine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;6-propan-2-yl-7H-purine?
The IUPAC name of molecular hydrogen;6-propan-2-yl-7H-purine (CID 171499387) is molecular hydrogen;6-propan-2-yl-7H-purine.
What is the SMILES notation for molecular hydrogen;6-propan-2-yl-7H-purine?
The canonical SMILES for molecular hydrogen;6-propan-2-yl-7H-purine is CC(C)c1ncnc2nc[nH]c12.[H][H].
What is the InChIKey of molecular hydrogen;6-propan-2-yl-7H-purine?
The InChIKey is DNHHCDWTNJOMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4.H2/c1-5(2)6-7-8(11-3-9-6)12-4-10-7;/h3-5H,1-2H3,(H,9,10,11,12);1H.
What are the key properties of molecular hydrogen;6-propan-2-yl-7H-purine?
molecular hydrogen;6-propan-2-yl-7H-purine has a molecular weight of 164.21 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;6-propan-2-yl-7H-purine is sourced from PubChem (CID 171499387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).