About molecular hydrogen;6-propan-2-yl-7H-purine
molecular hydrogen;6-propan-2-yl-7H-purine (PubChem CID 171499387) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is molecular hydrogen;6-propan-2-yl-7H-purine.
Molecular Properties
| Compound Name | molecular hydrogen;6-propan-2-yl-7H-purine |
| PubChem CID | 171499387 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | molecular hydrogen;6-propan-2-yl-7H-purine |
| SMILES | CC(C)c1ncnc2nc[nH]c12.[H][H] |
| InChI | InChI=1S/C8H10N4.H2/c1-5(2)6-7-8(11-3-9-6)12-4-10-7;/h3-5H,1-2H3,(H,9,10,11,12);1H |
| InChIKey | DNHHCDWTNJOMJA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze molecular hydrogen;6-propan-2-yl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;6-propan-2-yl-7H-purine?
The IUPAC name of molecular hydrogen;6-propan-2-yl-7H-purine (CID 171499387) is molecular hydrogen;6-propan-2-yl-7H-purine.
What is the SMILES notation for molecular hydrogen;6-propan-2-yl-7H-purine?
The canonical SMILES for molecular hydrogen;6-propan-2-yl-7H-purine is CC(C)c1ncnc2nc[nH]c12.[H][H].
What is the InChIKey of molecular hydrogen;6-propan-2-yl-7H-purine?
The InChIKey is DNHHCDWTNJOMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4.H2/c1-5(2)6-7-8(11-3-9-6)12-4-10-7;/h3-5H,1-2H3,(H,9,10,11,12);1H.
What are the key properties of molecular hydrogen;6-propan-2-yl-7H-purine?
molecular hydrogen;6-propan-2-yl-7H-purine has a molecular weight of 164.21 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;6-propan-2-yl-7H-purine is sourced from PubChem (CID 171499387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).