C10H15N3 — CID 144881517
7-butan-2-yl-1H-imidazo[4,5-b]pyridine;molecular hydrogen (PubChem CID 144881517) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 7-butan-2-yl-1H-imidazo[4,5-b]pyridine;molecular hydrogen.
| Compound Name | 7-butan-2-yl-1H-imidazo[4,5-b]pyridine;molecular hydrogen |
|---|---|
| PubChem CID | 144881517 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 7-butan-2-yl-1H-imidazo[4,5-b]pyridine;molecular hydrogen |
| SMILES | CCC(C)c1ccnc2nc[nH]c12.[H][H] |
| InChI | InChI=1S/C10H13N3.H2/c1-3-7(2)8-4-5-11-10-9(8)12-6-13-10;/h4-7H,3H2,1-2H3,(H,11,12,13);1H |
| InChIKey | IBYZTDHMQYWFQG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |