C10H14N2O — CID 170960607
7-butan-2-yl-2,3-dihydro-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 170960607) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 7-butan-2-yl-2,3-dihydro-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 7-butan-2-yl-2,3-dihydro-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 170960607 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 7-butan-2-yl-2,3-dihydro-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | CCC(C)c1ccnc2c1OCN2 |
| InChI | InChI=1S/C10H14N2O/c1-3-7(2)8-4-5-11-10-9(8)13-6-12-10/h4-5,7H,3,6H2,1-2H3,(H,11,12) |
| InChIKey | VULZQLJYJIOPES-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |