C20H24N2Ru — CID 58161913
4,7-di(butan-2-yl)-1,10-phenanthroline;ruthenium (PubChem CID 58161913) has the molecular formula C20H24N2Ru and a molecular weight of 393.50 g/mol. Its IUPAC name is 4,7-di(butan-2-yl)-1,10-phenanthroline;ruthenium.
| Compound Name | 4,7-di(butan-2-yl)-1,10-phenanthroline;ruthenium |
|---|---|
| PubChem CID | 58161913 |
| Molecular Formula | C20H24N2Ru |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 4,7-di(butan-2-yl)-1,10-phenanthroline;ruthenium |
| SMILES | CCC(C)c1ccnc2c1ccc1c(C(C)CC)ccnc12.[Ru] |
| InChI | InChI=1S/C20H24N2.Ru/c1-5-13(3)15-9-11-21-19-17(15)7-8-18-16(14(4)6-2)10-12-22-20(18)19;/h7-14H,5-6H2,1-4H3; |
| InChIKey | PTQVTEJVGZGBHL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|