C13H13Br2N — CID 147059986
1,5-dibromo-6-butan-2-ylisoquinoline (PubChem CID 147059986) has the molecular formula C13H13Br2N and a molecular weight of 343.06 g/mol. Its IUPAC name is 1,5-dibromo-6-butan-2-ylisoquinoline.
| Compound Name | 1,5-dibromo-6-butan-2-ylisoquinoline |
|---|---|
| PubChem CID | 147059986 |
| Molecular Formula | C13H13Br2N |
| Molecular Weight | 343.06 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 1,5-dibromo-6-butan-2-ylisoquinoline |
| SMILES | CCC(C)c1ccc2c(Br)nccc2c1Br |
| InChI | InChI=1S/C13H13Br2N/c1-3-8(2)9-4-5-11-10(12(9)14)6-7-16-13(11)15/h4-8H,3H2,1-2H3 |
| InChIKey | BCZGVAJFHULBJN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.06 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|