About 5-butan-2-ylquinoxaline
5-butan-2-ylquinoxaline (PubChem CID 123654553) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 5-butan-2-ylquinoxaline.
Molecular Properties
| Compound Name | 5-butan-2-ylquinoxaline |
| PubChem CID | 123654553 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 5-butan-2-ylquinoxaline |
| SMILES | CCC(C)c1cccc2nccnc12 |
| InChI | InChI=1S/C12H14N2/c1-3-9(2)10-5-4-6-11-12(10)14-8-7-13-11/h4-9H,3H2,1-2H3 |
| InChIKey | YLRSLPIWQFVPNB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butan-2-ylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-ylquinoxaline?
The IUPAC name of 5-butan-2-ylquinoxaline (CID 123654553) is 5-butan-2-ylquinoxaline.
What is the SMILES notation for 5-butan-2-ylquinoxaline?
The canonical SMILES for 5-butan-2-ylquinoxaline is CCC(C)c1cccc2nccnc12.
What is the InChIKey of 5-butan-2-ylquinoxaline?
The InChIKey is YLRSLPIWQFVPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-3-9(2)10-5-4-6-11-12(10)14-8-7-13-11/h4-9H,3H2,1-2H3.
What are the key properties of 5-butan-2-ylquinoxaline?
5-butan-2-ylquinoxaline has a molecular weight of 186.26 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-ylquinoxaline is sourced from PubChem (CID 123654553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).