C19H20N2 — CID 91110589
5-butan-2-yl-3-methyl-2-phenylquinoxaline (PubChem CID 91110589) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 5-butan-2-yl-3-methyl-2-phenylquinoxaline.
| Compound Name | 5-butan-2-yl-3-methyl-2-phenylquinoxaline |
|---|---|
| PubChem CID | 91110589 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 5-butan-2-yl-3-methyl-2-phenylquinoxaline |
| SMILES | CCC(C)c1cccc2nc(-c3ccccc3)c(C)nc12 |
| InChI | InChI=1S/C19H20N2/c1-4-13(2)16-11-8-12-17-19(16)20-14(3)18(21-17)15-9-6-5-7-10-15/h5-13H,4H2,1-3H3 |
| InChIKey | BXUIYCAMDDFBIP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |