About 1-(7H-purin-6-yl)ethanol
1-(7H-purin-6-yl)ethanol (PubChem CID 18670461) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 1-(7H-purin-6-yl)ethanol.
Molecular Properties
| Compound Name | 1-(7H-purin-6-yl)ethanol |
| PubChem CID | 18670461 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 1-(7H-purin-6-yl)ethanol |
| SMILES | CC(O)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C7H8N4O/c1-4(12)5-6-7(10-2-8-5)11-3-9-6/h2-4,12H,1H3,(H,8,9,10,11) |
| InChIKey | IHWHNEYSRQOARC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(7H-purin-6-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7H-purin-6-yl)ethanol?
The IUPAC name of 1-(7H-purin-6-yl)ethanol (CID 18670461) is 1-(7H-purin-6-yl)ethanol.
What is the SMILES notation for 1-(7H-purin-6-yl)ethanol?
The canonical SMILES for 1-(7H-purin-6-yl)ethanol is CC(O)c1ncnc2nc[nH]c12.
What is the InChIKey of 1-(7H-purin-6-yl)ethanol?
The InChIKey is IHWHNEYSRQOARC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-4(12)5-6-7(10-2-8-5)11-3-9-6/h2-4,12H,1H3,(H,8,9,10,11).
What are the key properties of 1-(7H-purin-6-yl)ethanol?
1-(7H-purin-6-yl)ethanol has a molecular weight of 164.17 g/mol, XLogP of 0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7H-purin-6-yl)ethanol is sourced from PubChem (CID 18670461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).