C8H10N4O3 — CID 170818005
1-(7H-purin-6-yl)propane-1,2,3-triol (PubChem CID 170818005) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is 1-(7H-purin-6-yl)propane-1,2,3-triol.
| Compound Name | 1-(7H-purin-6-yl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818005 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(7H-purin-6-yl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C8H10N4O3/c13-1-4(14)7(15)5-6-8(11-2-9-5)12-3-10-6/h2-4,7,13-15H,1H2,(H,9,10,11,12) |
| InChIKey | GGDMIVHHFMTNIF-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |