C8H9ClN4OS — CID 10467018
1-chloro-3-(7H-purin-6-ylsulfanyl)propan-2-ol (PubChem CID 10467018) has the molecular formula C8H9ClN4OS and a molecular weight of 244.71 g/mol. Its IUPAC name is 1-chloro-3-(7H-purin-6-ylsulfanyl)propan-2-ol.
| Compound Name | 1-chloro-3-(7H-purin-6-ylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 10467018 |
| Molecular Formula | C8H9ClN4OS |
| Molecular Weight | 244.71 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 1-chloro-3-(7H-purin-6-ylsulfanyl)propan-2-ol |
| SMILES | OC(CCl)CSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C8H9ClN4OS/c9-1-5(14)2-15-8-6-7(11-3-10-6)12-4-13-8/h3-5,14H,1-2H2,(H,10,11,12,13) |
| InChIKey | SBFPNPUFMUADFB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.71 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|