C13H19N5S — CID 104755514
1-cyclohexyl-2-(7H-purin-6-ylsulfanyl)ethanamine (PubChem CID 104755514) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is 1-cyclohexyl-2-(7H-purin-6-ylsulfanyl)ethanamine.
| Compound Name | 1-cyclohexyl-2-(7H-purin-6-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 104755514 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-cyclohexyl-2-(7H-purin-6-ylsulfanyl)ethanamine |
| SMILES | NC(CSc1ncnc2nc[nH]c12)C1CCCCC1 |
| InChI | InChI=1S/C13H19N5S/c14-10(9-4-2-1-3-5-9)6-19-13-11-12(16-7-15-11)17-8-18-13/h7-10H,1-6,14H2,(H,15,16,17,18) |
| InChIKey | HDKJAZVRAZAFNF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |