C12H18N6OS — CID 62254679
2-methyl-2-(propan-2-ylamino)-3-(7H-purin-6-ylsulfanyl)propanamide (PubChem CID 62254679) has the molecular formula C12H18N6OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-methyl-2-(propan-2-ylamino)-3-(7H-purin-6-ylsulfanyl)propanamide.
| Compound Name | 2-methyl-2-(propan-2-ylamino)-3-(7H-purin-6-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 62254679 |
| Molecular Formula | C12H18N6OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-methyl-2-(propan-2-ylamino)-3-(7H-purin-6-ylsulfanyl)propanamide |
| SMILES | CC(C)NC(C)(CSc1ncnc2nc[nH]c12)C(N)=O |
| InChI | InChI=1S/C12H18N6OS/c1-7(2)18-12(3,11(13)19)4-20-10-8-9(15-5-14-8)16-6-17-10/h5-7,18H,4H2,1-3H3,(H2,13,19)(H,14,15,16,17) |
| InChIKey | NQHLVFOMWJWVAH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |