C12H19N5S — CID 64635042
N,3,3-trimethyl-1-(7H-purin-6-ylsulfanyl)butan-2-amine (PubChem CID 64635042) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is N,3,3-trimethyl-1-(7H-purin-6-ylsulfanyl)butan-2-amine.
| Compound Name | N,3,3-trimethyl-1-(7H-purin-6-ylsulfanyl)butan-2-amine |
|---|---|
| PubChem CID | 64635042 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N,3,3-trimethyl-1-(7H-purin-6-ylsulfanyl)butan-2-amine |
| SMILES | CNC(CSc1ncnc2nc[nH]c12)C(C)(C)C |
| InChI | InChI=1S/C12H19N5S/c1-12(2,3)8(13-4)5-18-11-9-10(15-6-14-9)16-7-17-11/h6-8,13H,5H2,1-4H3,(H,14,15,16,17) |
| InChIKey | OGWAGYMFIWKBJG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |