C10H14N4S — CID 3457706
6-(2-methylbutan-2-ylsulfanyl)-7H-purine (PubChem CID 3457706) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 6-(2-methylbutan-2-ylsulfanyl)-7H-purine.
| Compound Name | 6-(2-methylbutan-2-ylsulfanyl)-7H-purine |
|---|---|
| PubChem CID | 3457706 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 6-(2-methylbutan-2-ylsulfanyl)-7H-purine |
| SMILES | CCC(C)(C)Sc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C10H14N4S/c1-4-10(2,3)15-9-7-8(12-5-11-7)13-6-14-9/h5-6H,4H2,1-3H3,(H,11,12,13,14) |
| InChIKey | NVAPPQGNQBNNLD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |