C13H18N6S — CID 62253618
2-methyl-2-(methylamino)-6-(7H-purin-6-ylsulfanyl)hexanenitrile (PubChem CID 62253618) has the molecular formula C13H18N6S and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-6-(7H-purin-6-ylsulfanyl)hexanenitrile.
| Compound Name | 2-methyl-2-(methylamino)-6-(7H-purin-6-ylsulfanyl)hexanenitrile |
|---|---|
| PubChem CID | 62253618 |
| Molecular Formula | C13H18N6S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-methyl-2-(methylamino)-6-(7H-purin-6-ylsulfanyl)hexanenitrile |
| SMILES | CNC(C)(C#N)CCCCSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C13H18N6S/c1-13(7-14,15-2)5-3-4-6-20-12-10-11(17-8-16-10)18-9-19-12/h8-9,15H,3-6H2,1-2H3,(H,16,17,18,19) |
| InChIKey | KWDDBQJZWZGBGK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|