C12H15N5S — CID 65257500
2,2-dimethyl-5-(7H-purin-6-ylsulfanyl)pentanenitrile (PubChem CID 65257500) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2,2-dimethyl-5-(7H-purin-6-ylsulfanyl)pentanenitrile.
| Compound Name | 2,2-dimethyl-5-(7H-purin-6-ylsulfanyl)pentanenitrile |
|---|---|
| PubChem CID | 65257500 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2,2-dimethyl-5-(7H-purin-6-ylsulfanyl)pentanenitrile |
| SMILES | CC(C)(C#N)CCCSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H15N5S/c1-12(2,6-13)4-3-5-18-11-9-10(15-7-14-9)16-8-17-11/h7-8H,3-5H2,1-2H3,(H,14,15,16,17) |
| InChIKey | YTWKTXHDDGOZJC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|