C14H14N4S — CID 135397811
6-(3-phenylpropylsulfanyl)-7H-purine (PubChem CID 135397811) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 6-(3-phenylpropylsulfanyl)-7H-purine.
| Compound Name | 6-(3-phenylpropylsulfanyl)-7H-purine |
|---|---|
| PubChem CID | 135397811 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 6-(3-phenylpropylsulfanyl)-7H-purine |
| SMILES | c1ccc(CCCSc2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C14H14N4S/c1-2-5-11(6-3-1)7-4-8-19-14-12-13(16-9-15-12)17-10-18-14/h1-3,5-6,9-10H,4,7-8H2,(H,15,16,17,18) |
| InChIKey | HSQATAOBYBSXFM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|