C13H12N4S2 — CID 146314022
6-[(4-methylsulfanylphenyl)methylsulfanyl]-7H-purine (PubChem CID 146314022) has the molecular formula C13H12N4S2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 6-[(4-methylsulfanylphenyl)methylsulfanyl]-7H-purine.
| Compound Name | 6-[(4-methylsulfanylphenyl)methylsulfanyl]-7H-purine |
|---|---|
| PubChem CID | 146314022 |
| Molecular Formula | C13H12N4S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 6-[(4-methylsulfanylphenyl)methylsulfanyl]-7H-purine |
| SMILES | CSc1ccc(CSc2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C13H12N4S2/c1-18-10-4-2-9(3-5-10)6-19-13-11-12(15-7-14-11)16-8-17-13/h2-5,7-8H,6H2,1H3,(H,14,15,16,17) |
| InChIKey | CKQGHSFGJJURHZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |