C10H8N6S — CID 171816697
6-(pyridazin-3-ylmethylsulfanyl)-7H-purine (PubChem CID 171816697) has the molecular formula C10H8N6S and a molecular weight of 244.28 g/mol. Its IUPAC name is 6-(pyridazin-3-ylmethylsulfanyl)-7H-purine.
| Compound Name | 6-(pyridazin-3-ylmethylsulfanyl)-7H-purine |
|---|---|
| PubChem CID | 171816697 |
| Molecular Formula | C10H8N6S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 6-(pyridazin-3-ylmethylsulfanyl)-7H-purine |
| SMILES | c1cnnc(CSc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C10H8N6S/c1-2-7(16-15-3-1)4-17-10-8-9(12-5-11-8)13-6-14-10/h1-3,5-6H,4H2,(H,11,12,13,14) |
| InChIKey | PIDYBGOWNNDWKE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |