C15H11N6OSY- — CID 59039051
5-methyl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-3-id-4-one;yttrium (PubChem CID 59039051) has the molecular formula C15H11N6OSY- and a molecular weight of 412.27 g/mol. Its IUPAC name is 5-methyl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-3-id-4-one;yttrium.
| Compound Name | 5-methyl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-3-id-4-one;yttrium |
|---|---|
| PubChem CID | 59039051 |
| Molecular Formula | C15H11N6OSY- |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | 5-methyl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-3-id-4-one;yttrium |
| SMILES | Cc1cccc2nc(CSc3ncnc4nc[nH]c34)[n-]c(=O)c12.[Y] |
| InChI | InChI=1S/C15H12N6OS.Y/c1-8-3-2-4-9-11(8)14(22)21-10(20-9)5-23-15-12-13(17-6-16-12)18-7-19-15;/h2-4,6-7H,5H2,1H3,(H2,16,17,18,19,20,21,22);/p-1 |
| InChIKey | WDXSJUYQNCHMPO-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 98.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |