C21H15FN6OS — CID 172765508
3-(2-fluorophenyl)-5-methyl-2-(7H-purin-6-ylmethylsulfanyl)quinazolin-4-one (PubChem CID 172765508) has the molecular formula C21H15FN6OS and a molecular weight of 418.46 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-5-methyl-2-(7H-purin-6-ylmethylsulfanyl)quinazolin-4-one.
| Compound Name | 3-(2-fluorophenyl)-5-methyl-2-(7H-purin-6-ylmethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 172765508 |
| Molecular Formula | C21H15FN6OS |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 3-(2-fluorophenyl)-5-methyl-2-(7H-purin-6-ylmethylsulfanyl)quinazolin-4-one |
| SMILES | Cc1cccc2nc(SCc3ncnc4nc[nH]c34)n(-c3ccccc3F)c(=O)c12 |
| InChI | InChI=1S/C21H15FN6OS/c1-12-5-4-7-14-17(12)20(29)28(16-8-3-2-6-13(16)22)21(27-14)30-9-15-18-19(25-10-23-15)26-11-24-18/h2-8,10-11H,9H2,1H3,(H,23,24,25,26) |
| InChIKey | MGILONGYTPZIPF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |