C22H17FN6OS — CID 87241996
3-(2-fluorophenyl)-5-methyl-2-[2-(7H-purin-6-yl)-2-sulfanylethyl]quinazolin-4-one (PubChem CID 87241996) has the molecular formula C22H17FN6OS and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-5-methyl-2-[2-(7H-purin-6-yl)-2-sulfanylethyl]quinazolin-4-one.
| Compound Name | 3-(2-fluorophenyl)-5-methyl-2-[2-(7H-purin-6-yl)-2-sulfanylethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 87241996 |
| Molecular Formula | C22H17FN6OS |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 3-(2-fluorophenyl)-5-methyl-2-[2-(7H-purin-6-yl)-2-sulfanylethyl]quinazolin-4-one |
| SMILES | Cc1cccc2nc(CC(S)c3ncnc4nc[nH]c34)n(-c3ccccc3F)c(=O)c12 |
| InChI | InChI=1S/C22H17FN6OS/c1-12-5-4-7-14-18(12)22(30)29(15-8-3-2-6-13(15)23)17(28-14)9-16(31)19-20-21(26-10-24-19)27-11-25-20/h2-8,10-11,16,31H,9H2,1H3,(H,24,25,26,27) |
| InChIKey | LDADJTPVBPHPQJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|