C21H14ClF2N7O — CID 118043919
5-chloro-6-fluoro-3-(2-fluorophenyl)-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one (PubChem CID 118043919) has the molecular formula C21H14ClF2N7O and a molecular weight of 453.84 g/mol. Its IUPAC name is 5-chloro-6-fluoro-3-(2-fluorophenyl)-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one.
| Compound Name | 5-chloro-6-fluoro-3-(2-fluorophenyl)-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 118043919 |
| Molecular Formula | C21H14ClF2N7O |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 5-chloro-6-fluoro-3-(2-fluorophenyl)-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1nc2ccc(F)c(Cl)c2c(=O)n1-c1ccccc1F |
| InChI | InChI=1S/C21H14ClF2N7O/c1-10(29-19-17-18(26-8-25-17)27-9-28-19)20-30-13-7-6-12(24)16(22)15(13)21(32)31(20)14-5-3-2-4-11(14)23/h2-10H,1H3,(H2,25,26,27,28,29) |
| InChIKey | CSKGGYVUJJKOOX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |