C22H19ClN8O — CID 20871489
3-(2-chlorophenyl)-5-(dimethylamino)-2-[(7H-purin-6-ylamino)methyl]quinazolin-4-one (PubChem CID 20871489) has the molecular formula C22H19ClN8O and a molecular weight of 446.90 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-(dimethylamino)-2-[(7H-purin-6-ylamino)methyl]quinazolin-4-one.
| Compound Name | 3-(2-chlorophenyl)-5-(dimethylamino)-2-[(7H-purin-6-ylamino)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 20871489 |
| Molecular Formula | C22H19ClN8O |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-(2-chlorophenyl)-5-(dimethylamino)-2-[(7H-purin-6-ylamino)methyl]quinazolin-4-one |
| SMILES | CN(C)c1cccc2nc(CNc3ncnc4nc[nH]c34)n(-c3ccccc3Cl)c(=O)c12 |
| InChI | InChI=1S/C22H19ClN8O/c1-30(2)16-9-5-7-14-18(16)22(32)31(15-8-4-3-6-13(15)23)17(29-14)10-24-20-19-21(26-11-25-19)28-12-27-20/h3-9,11-12H,10H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | OTCWZRRKVWSVOV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |