C22H23N9O — CID 144567069
ethane;5-methyl-2-[(7H-purin-6-ylamino)methyl]-3-(pyridin-4-ylamino)quinazolin-4-one (PubChem CID 144567069) has the molecular formula C22H23N9O and a molecular weight of 429.49 g/mol. Its IUPAC name is ethane;5-methyl-2-[(7H-purin-6-ylamino)methyl]-3-(pyridin-4-ylamino)quinazolin-4-one.
| Compound Name | ethane;5-methyl-2-[(7H-purin-6-ylamino)methyl]-3-(pyridin-4-ylamino)quinazolin-4-one |
|---|---|
| PubChem CID | 144567069 |
| Molecular Formula | C22H23N9O |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | ethane;5-methyl-2-[(7H-purin-6-ylamino)methyl]-3-(pyridin-4-ylamino)quinazolin-4-one |
| SMILES | CC.Cc1cccc2nc(CNc3ncnc4nc[nH]c34)n(Nc3ccncc3)c(=O)c12 |
| InChI | InChI=1S/C20H17N9O.C2H6/c1-12-3-2-4-14-16(12)20(30)29(28-13-5-7-21-8-6-13)15(27-14)9-22-18-17-19(24-10-23-17)26-11-25-18;1-2/h2-8,10-11H,9H2,1H3,(H,21,28)(H2,22,23,24,25,26);1-2H3 |
| InChIKey | KJWFLXORXLDKOB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |