C19H14ClN9O — CID 123870667
5-chloro-2-[(7H-purin-6-ylamino)methyl]-3-(pyridin-4-ylamino)quinazolin-4-one (PubChem CID 123870667) has the molecular formula C19H14ClN9O and a molecular weight of 419.84 g/mol. Its IUPAC name is 5-chloro-2-[(7H-purin-6-ylamino)methyl]-3-(pyridin-4-ylamino)quinazolin-4-one.
| Compound Name | 5-chloro-2-[(7H-purin-6-ylamino)methyl]-3-(pyridin-4-ylamino)quinazolin-4-one |
|---|---|
| PubChem CID | 123870667 |
| Molecular Formula | C19H14ClN9O |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 5-chloro-2-[(7H-purin-6-ylamino)methyl]-3-(pyridin-4-ylamino)quinazolin-4-one |
| SMILES | O=c1c2c(Cl)cccc2nc(CNc2ncnc3nc[nH]c23)n1Nc1ccncc1 |
| InChI | InChI=1S/C19H14ClN9O/c20-12-2-1-3-13-15(12)19(30)29(28-11-4-6-21-7-5-11)14(27-13)8-22-17-16-18(24-9-23-16)26-10-25-17/h1-7,9-10H,8H2,(H,21,28)(H2,22,23,24,25,26) |
| InChIKey | WMOVZKNMADJVPU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |