C19H23FN8O — CID 144566973
ethane;5-fluoro-3-(propan-2-ylamino)-2-[(7H-purin-6-ylamino)methyl]quinazolin-4-one (PubChem CID 144566973) has the molecular formula C19H23FN8O and a molecular weight of 398.45 g/mol. Its IUPAC name is ethane;5-fluoro-3-(propan-2-ylamino)-2-[(7H-purin-6-ylamino)methyl]quinazolin-4-one.
| Compound Name | ethane;5-fluoro-3-(propan-2-ylamino)-2-[(7H-purin-6-ylamino)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 144566973 |
| Molecular Formula | C19H23FN8O |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | ethane;5-fluoro-3-(propan-2-ylamino)-2-[(7H-purin-6-ylamino)methyl]quinazolin-4-one |
| SMILES | CC.CC(C)Nn1c(CNc2ncnc3nc[nH]c23)nc2cccc(F)c2c1=O |
| InChI | InChI=1S/C17H17FN8O.C2H6/c1-9(2)25-26-12(24-11-5-3-4-10(18)13(11)17(26)27)6-19-15-14-16(21-7-20-14)23-8-22-15;1-2/h3-5,7-9,25H,6H2,1-2H3,(H2,19,20,21,22,23);1-2H3 |
| InChIKey | NHCPGGGHNTXGMI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |