C20H13AsClN7O — CID 87729254
CID 87729254 (PubChem CID 87729254) has the molecular formula C20H13AsClN7O and a molecular weight of 477.75 g/mol.
| Compound Name | CID 87729254 |
|---|---|
| PubChem CID | 87729254 |
| Molecular Formula | C20H13AsClN7O |
| Molecular Weight | 477.75 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | — |
| SMILES | O=c1c2c(Cl)cccc2nc(CNc2nc([As])nc3nc[nH]c23)n1-c1ccccc1 |
| InChI | InChI=1S/C20H13AsClN7O/c21-20-27-17(16-18(28-20)25-10-24-16)23-9-14-26-13-8-4-7-12(22)15(13)19(30)29(14)11-5-2-1-3-6-11/h1-8,10H,9H2,(H2,23,24,25,27,28) |
| InChIKey | SBNMBBZTSDTBJR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.75 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|