C20H13ClN6OS — CID 1093514
3-(2-chlorophenyl)-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one (PubChem CID 1093514) has the molecular formula C20H13ClN6OS and a molecular weight of 420.89 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one.
| Compound Name | 3-(2-chlorophenyl)-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 1093514 |
| Molecular Formula | C20H13ClN6OS |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 3-(2-chlorophenyl)-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(CSc2ncnc3nc[nH]c23)n1-c1ccccc1Cl |
| InChI | InChI=1S/C20H13ClN6OS/c21-13-6-2-4-8-15(13)27-16(26-14-7-3-1-5-12(14)20(27)28)9-29-19-17-18(23-10-22-17)24-11-25-19/h1-8,10-11H,9H2,(H,22,23,24,25) |
| InChIKey | KJQLFFHRDREFOS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |