C26H31N7OS — CID 123704730
ethane;3-[3-(methylaminomethyl)phenyl]-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one (PubChem CID 123704730) has the molecular formula C26H31N7OS and a molecular weight of 489.65 g/mol. Its IUPAC name is ethane;3-[3-(methylaminomethyl)phenyl]-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one.
| Compound Name | ethane;3-[3-(methylaminomethyl)phenyl]-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 123704730 |
| Molecular Formula | C26H31N7OS |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | ethane;3-[3-(methylaminomethyl)phenyl]-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
| SMILES | CC.CC.CNCc1cccc(-n2c(CSc3ncnc4nc[nH]c34)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C22H19N7OS.2C2H6/c1-23-10-14-5-4-6-15(9-14)29-18(28-17-8-3-2-7-16(17)22(29)30)11-31-21-19-20(25-12-24-19)26-13-27-21;2*1-2/h2-9,12-13,23H,10-11H2,1H3,(H,24,25,26,27);2*1-2H3 |
| InChIKey | UPQUNDUBSXBKRN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |