C12H12N6S — CID 62469468
N-methyl-3-(7H-purin-6-ylsulfanylmethyl)pyridin-2-amine (PubChem CID 62469468) has the molecular formula C12H12N6S and a molecular weight of 272.34 g/mol. Its IUPAC name is N-methyl-3-(7H-purin-6-ylsulfanylmethyl)pyridin-2-amine.
| Compound Name | N-methyl-3-(7H-purin-6-ylsulfanylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62469468 |
| Molecular Formula | C12H12N6S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-methyl-3-(7H-purin-6-ylsulfanylmethyl)pyridin-2-amine |
| SMILES | CNc1ncccc1CSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H12N6S/c1-13-10-8(3-2-4-14-10)5-19-12-9-11(16-6-15-9)17-7-18-12/h2-4,6-7H,5H2,1H3,(H,13,14)(H,15,16,17,18) |
| InChIKey | ADBCUIZULNWFSH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |